C18H34NO8P — CID 122451773
1-O-tert-butyl 3-O-ethyl 4-(diethoxyphosphoryloxymethyl)piperidine-1,3-dicarboxylate (PubChem CID 122451773) has the molecular formula C18H34NO8P and a molecular weight of 423.44 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 4-(diethoxyphosphoryloxymethyl)piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 4-(diethoxyphosphoryloxymethyl)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 122451773 |
| Molecular Formula | C18H34NO8P |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 4-(diethoxyphosphoryloxymethyl)piperidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)CCC1COP(=O)(OCC)OCC |
| InChI | InChI=1S/C18H34NO8P/c1-7-23-16(20)15-12-19(17(21)27-18(4,5)6)11-10-14(15)13-26-28(22,24-8-2)25-9-3/h14-15H,7-13H2,1-6H3 |
| InChIKey | RJMBFPHACKULIQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|