C22H17F3N2O4S — CID 122454265
5-[4-hydroxy-2-(trifluoromethyl)phenyl]-4-(3-pyridin-3-yloxypropyl)thieno[3,2-b]pyrrole-2-carboxylic acid (PubChem CID 122454265) has the molecular formula C22H17F3N2O4S and a molecular weight of 462.45 g/mol. Its IUPAC name is 5-[4-hydroxy-2-(trifluoromethyl)phenyl]-4-(3-pyridin-3-yloxypropyl)thieno[3,2-b]pyrrole-2-carboxylic acid.
| Compound Name | 5-[4-hydroxy-2-(trifluoromethyl)phenyl]-4-(3-pyridin-3-yloxypropyl)thieno[3,2-b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 122454265 |
| Molecular Formula | C22H17F3N2O4S |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 5-[4-hydroxy-2-(trifluoromethyl)phenyl]-4-(3-pyridin-3-yloxypropyl)thieno[3,2-b]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(cc(-c3ccc(O)cc3C(F)(F)F)n2CCCOc2cccnc2)s1 |
| InChI | InChI=1S/C22H17F3N2O4S/c23-22(24,25)16-9-13(28)4-5-15(16)17-10-19-18(11-20(32-19)21(29)30)27(17)7-2-8-31-14-3-1-6-26-12-14/h1,3-6,9-12,28H,2,7-8H2,(H,29,30) |
| InChIKey | NIWBFEBXPDJBEF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|