C20H15Cl2N3O3 — CID 122454889
4-[1-(2,4-dichloropyridine-3-carbonyl)-4,5,6,7-tetrahydroindazol-3-yl]benzoic acid (PubChem CID 122454889) has the molecular formula C20H15Cl2N3O3 and a molecular weight of 416.26 g/mol. Its IUPAC name is 4-[1-(2,4-dichloropyridine-3-carbonyl)-4,5,6,7-tetrahydroindazol-3-yl]benzoic acid.
| Compound Name | 4-[1-(2,4-dichloropyridine-3-carbonyl)-4,5,6,7-tetrahydroindazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 122454889 |
| Molecular Formula | C20H15Cl2N3O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 4-[1-(2,4-dichloropyridine-3-carbonyl)-4,5,6,7-tetrahydroindazol-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nn(C(=O)c3c(Cl)ccnc3Cl)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C20H15Cl2N3O3/c21-14-9-10-23-18(22)16(14)19(26)25-15-4-2-1-3-13(15)17(24-25)11-5-7-12(8-6-11)20(27)28/h5-10H,1-4H2,(H,27,28) |
| InChIKey | SQEUIBJLRWKSFD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|