C32H58O8 — CID 122455200
2,2-bis(7-methyloctyl)hexanedioic acid;cyclohexane-1,1-dicarboxylic acid (PubChem CID 122455200) has the molecular formula C32H58O8 and a molecular weight of 570.81 g/mol. Its IUPAC name is 2,2-bis(7-methyloctyl)hexanedioic acid;cyclohexane-1,1-dicarboxylic acid.
| Compound Name | 2,2-bis(7-methyloctyl)hexanedioic acid;cyclohexane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 122455200 |
| Molecular Formula | C32H58O8 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.41 |
| IUPAC Name | 2,2-bis(7-methyloctyl)hexanedioic acid;cyclohexane-1,1-dicarboxylic acid |
| SMILES | CC(C)CCCCCCC(CCCCCCC(C)C)(CCCC(=O)O)C(=O)O.O=C(O)C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C24H46O4.C8H12O4/c1-20(2)14-9-5-7-11-17-24(23(27)28,19-13-16-22(25)26)18-12-8-6-10-15-21(3)4;9-6(10)8(7(11)12)4-2-1-3-5-8/h20-21H,5-19H2,1-4H3,(H,25,26)(H,27,28);1-5H2,(H,9,10)(H,11,12) |
| InChIKey | AVTSPGVMTXXNRJ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|