C9H11F3N4O — CID 122456079
[6-[3-(trifluoromethoxy)azetidin-1-yl]pyrimidin-4-yl]methanamine (PubChem CID 122456079) has the molecular formula C9H11F3N4O and a molecular weight of 248.21 g/mol. Its IUPAC name is [6-[3-(trifluoromethoxy)azetidin-1-yl]pyrimidin-4-yl]methanamine.
| Compound Name | [6-[3-(trifluoromethoxy)azetidin-1-yl]pyrimidin-4-yl]methanamine |
|---|---|
| PubChem CID | 122456079 |
| Molecular Formula | C9H11F3N4O |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [6-[3-(trifluoromethoxy)azetidin-1-yl]pyrimidin-4-yl]methanamine |
| SMILES | NCc1cc(N2CC(OC(F)(F)F)C2)ncn1 |
| InChI | InChI=1S/C9H11F3N4O/c10-9(11,12)17-7-3-16(4-7)8-1-6(2-13)14-5-15-8/h1,5,7H,2-4,13H2 |
| InChIKey | RMLWMZVYDSWKLI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |