C13H15F3N4O2 — CID 139564069
N-[[2-cyclopropyl-6-[3-(trifluoromethoxy)azetidin-1-yl]pyrimidin-4-yl]methyl]formamide (PubChem CID 139564069) has the molecular formula C13H15F3N4O2 and a molecular weight of 316.28 g/mol. Its IUPAC name is N-[[2-cyclopropyl-6-[3-(trifluoromethoxy)azetidin-1-yl]pyrimidin-4-yl]methyl]formamide.
| Compound Name | N-[[2-cyclopropyl-6-[3-(trifluoromethoxy)azetidin-1-yl]pyrimidin-4-yl]methyl]formamide |
|---|---|
| PubChem CID | 139564069 |
| Molecular Formula | C13H15F3N4O2 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-[[2-cyclopropyl-6-[3-(trifluoromethoxy)azetidin-1-yl]pyrimidin-4-yl]methyl]formamide |
| SMILES | O=CNCc1cc(N2CC(OC(F)(F)F)C2)nc(C2CC2)n1 |
| InChI | InChI=1S/C13H15F3N4O2/c14-13(15,16)22-10-5-20(6-10)11-3-9(4-17-7-21)18-12(19-11)8-1-2-8/h3,7-8,10H,1-2,4-6H2,(H,17,21) |
| InChIKey | WRGBFFKGOKUVON-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|