C11H17N5O — CID 122456372
(3R)-1-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 122456372) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is (3R)-1-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 122456372 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (3R)-1-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | Nc1nc(NC2CC2)cc(N2CC[C@@H](O)C2)n1 |
| InChI | InChI=1S/C11H17N5O/c12-11-14-9(13-7-1-2-7)5-10(15-11)16-4-3-8(17)6-16/h5,7-8,17H,1-4,6H2,(H3,12,13,14,15)/t8-/m1/s1 |
| InChIKey | GWAQHSYEJAYGOZ-MRVPVSSYSA-N |
| XLogP | 0.20 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |