C41H63BrN6O9 — CID 122457053
6-(2-bromoethyl)-29,30-dibutoxy-20-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),11,13,15(30),25(29),26-hexaene-2,10,16,24-tetrone (PubChem CID 122457053) has the molecular formula C41H63BrN6O9 and a molecular weight of 863.89 g/mol. Its IUPAC name is 6-(2-bromoethyl)-29,30-dibutoxy-20-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),11,13,15(30),25(29),26-hexaene-2,10,16,24-tetrone.
| Compound Name | 6-(2-bromoethyl)-29,30-dibutoxy-20-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),11,13,15(30),25(29),26-hexaene-2,10,16,24-tetrone |
|---|---|
| PubChem CID | 122457053 |
| Molecular Formula | C41H63BrN6O9 |
| Molecular Weight | 863.89 g/mol |
| Exact Mass | 862.38 |
| IUPAC Name | 6-(2-bromoethyl)-29,30-dibutoxy-20-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),11,13,15(30),25(29),26-hexaene-2,10,16,24-tetrone |
| SMILES | CCCCOc1c2cccc1C(=O)NCCN(CCOCCOCCOC)CCNC(=O)c1cccc(c1OCCCC)C(=O)NCCN(CCBr)CCNC2=O |
| InChI | InChI=1S/C41H63BrN6O9/c1-4-6-25-56-36-32-10-8-12-34(36)40(51)45-17-22-48(24-27-54-30-31-55-29-28-53-3)23-18-46-41(52)35-13-9-11-33(37(35)57-26-7-5-2)39(50)44-16-21-47(19-14-42)20-15-43-38(32)49/h8-13H,4-7,14-31H2,1-3H3,(H,43,49)(H,44,50)(H,45,51)(H,46,52) |
| InChIKey | GSGVLJDJZWTXET-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 169.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.89 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|