C50H81N7O10 — CID 118137115
tert-butyl N-[2-(12,13,25,26-tetrabutoxy-2,10,15,23-tetraoxo-19-propyl-3,6,9,16,19,22-hexazatricyclo[22.2.2.211,14]triaconta-1(26),11,13,24,27,29-hexaen-6-yl)ethyl]carbamate (PubChem CID 118137115) has the molecular formula C50H81N7O10 and a molecular weight of 940.24 g/mol. Its IUPAC name is tert-butyl N-[2-(12,13,25,26-tetrabutoxy-2,10,15,23-tetraoxo-19-propyl-3,6,9,16,19,22-hexazatricyclo[22.2.2.211,14]triaconta-1(26),11,13,24,27,29-hexaen-6-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(12,13,25,26-tetrabutoxy-2,10,15,23-tetraoxo-19-propyl-3,6,9,16,19,22-hexazatricyclo[22.2.2.211,14]triaconta-1(26),11,13,24,27,29-hexaen-6-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 118137115 |
| Molecular Formula | C50H81N7O10 |
| Molecular Weight | 940.24 g/mol |
| Exact Mass | 939.60 |
| IUPAC Name | tert-butyl N-[2-(12,13,25,26-tetrabutoxy-2,10,15,23-tetraoxo-19-propyl-3,6,9,16,19,22-hexazatricyclo[22.2.2.211,14]triaconta-1(26),11,13,24,27,29-hexaen-6-yl)ethyl]carbamate |
| SMILES | CCCCOc1c2ccc(c1OCCCC)C(=O)NCCN(CCNC(=O)OC(C)(C)C)CCNC(=O)c1ccc(c(OCCCC)c1OCCCC)C(=O)NCCN(CCC)CCNC2=O |
| InChI | InChI=1S/C50H81N7O10/c1-9-14-33-63-41-37-18-20-39(43(41)65-35-16-11-3)47(60)53-24-30-57(32-26-55-49(62)67-50(6,7)8)31-25-54-48(61)40-21-19-38(42(64-34-15-10-2)44(40)66-36-17-12-4)46(59)52-23-29-56(27-13-5)28-22-51-45(37)58/h18-21H,9-17,22-36H2,1-8H3,(H,51,58)(H,52,59)(H,53,60)(H,54,61)(H,55,62) |
| InChIKey | PRBIGSUQJCASLO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 198.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.24 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|