C45H79N7O11 — CID 90175805
tert-butyl N-[2-[2-[2-[(1S,11R)-29,30-dibutoxy-20-(2-hydroxyethyl)-2,10,16,24-tetraoxo-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-14,25-dien-6-yl]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 90175805) has the molecular formula C45H79N7O11 and a molecular weight of 894.16 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[(1S,11R)-29,30-dibutoxy-20-(2-hydroxyethyl)-2,10,16,24-tetraoxo-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-14,25-dien-6-yl]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[(1S,11R)-29,30-dibutoxy-20-(2-hydroxyethyl)-2,10,16,24-tetraoxo-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-14,25-dien-6-yl]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 90175805 |
| Molecular Formula | C45H79N7O11 |
| Molecular Weight | 894.16 g/mol |
| Exact Mass | 893.58 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[(1S,11R)-29,30-dibutoxy-20-(2-hydroxyethyl)-2,10,16,24-tetraoxo-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-14,25-dien-6-yl]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CCCCOC1C2=CCC[C@@H]1C(=O)NCCN(CCOCCOCCNC(=O)OC(C)(C)C)CCNC(=O)[C@@H]1CCC=C(C(=O)NCCN(CCO)CCNC2=O)C1OCCCC |
| InChI | InChI=1S/C45H79N7O11/c1-6-8-28-61-38-34-12-10-14-36(38)42(56)48-18-23-52(26-31-60-33-32-59-30-20-50-44(58)63-45(3,4)5)24-19-49-43(57)37-15-11-13-35(39(37)62-29-9-7-2)41(55)47-17-22-51(25-27-53)21-16-46-40(34)54/h12-13,36-39,53H,6-11,14-33H2,1-5H3,(H,46,54)(H,47,55)(H,48,56)(H,49,57)(H,50,58)/t36-,37+,38?,39? |
| InChIKey | WBGBLNRTWRFNDH-BJPGZXLOSA-N |
| XLogP | 1.66 |
| TPSA | 218.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|