C20H21ClN4 — CID 122457687
1-[[4-(4-chlorophenyl)cinnolin-6-yl]methyl]piperidin-4-amine (PubChem CID 122457687) has the molecular formula C20H21ClN4 and a molecular weight of 352.87 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)cinnolin-6-yl]methyl]piperidin-4-amine.
| Compound Name | 1-[[4-(4-chlorophenyl)cinnolin-6-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 122457687 |
| Molecular Formula | C20H21ClN4 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)cinnolin-6-yl]methyl]piperidin-4-amine |
| SMILES | NC1CCN(Cc2ccc3nncc(-c4ccc(Cl)cc4)c3c2)CC1 |
| InChI | InChI=1S/C20H21ClN4/c21-16-4-2-15(3-5-16)19-12-23-24-20-6-1-14(11-18(19)20)13-25-9-7-17(22)8-10-25/h1-6,11-12,17H,7-10,13,22H2 |
| InChIKey | CBRVKWYCZIESQM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |