C18H21ClN2O — CID 69336944
1-[[4-(2-amino-5-chlorophenyl)phenyl]methyl]piperidin-4-ol (PubChem CID 69336944) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is 1-[[4-(2-amino-5-chlorophenyl)phenyl]methyl]piperidin-4-ol.
| Compound Name | 1-[[4-(2-amino-5-chlorophenyl)phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 69336944 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-[[4-(2-amino-5-chlorophenyl)phenyl]methyl]piperidin-4-ol |
| SMILES | Nc1ccc(Cl)cc1-c1ccc(CN2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C18H21ClN2O/c19-15-5-6-18(20)17(11-15)14-3-1-13(2-4-14)12-21-9-7-16(22)8-10-21/h1-6,11,16,22H,7-10,12,20H2 |
| InChIKey | OFQNJKVOSRDFJP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|