About 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol
1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol (PubChem CID 162718521) has the molecular formula C19H19Cl2N3O
and a molecular weight of 376.29 g/mol. Its IUPAC name is 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol |
| PubChem CID | 162718521 |
| Molecular Formula | C19H19Cl2N3O |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol |
| SMILES | OC1CCN(Cc2ccc(-c3cc(Cl)c4cn[nH]c4c3Cl)cc2)CC1 |
| InChI | InChI=1S/C19H19Cl2N3O/c20-17-9-15(18(21)19-16(17)10-22-23-19)13-3-1-12(2-4-13)11-24-7-5-14(25)6-8-24/h1-4,9-10,14,25H,5-8,11H2,(H,22,23) |
| InChIKey | VFRVXMIOFWDKMC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol?
The IUPAC name of 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol (CID 162718521) is 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol.
What is the SMILES notation for 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol?
The canonical SMILES for 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol is OC1CCN(Cc2ccc(-c3cc(Cl)c4cn[nH]c4c3Cl)cc2)CC1.
What is the InChIKey of 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol?
The InChIKey is VFRVXMIOFWDKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2N3O/c20-17-9-15(18(21)19-16(17)10-22-23-19)13-3-1-12(2-4-13)11-24-7-5-14(25)6-8-24/h1-4,9-10,14,25H,5-8,11H2,(H,22,23).
What are the key properties of 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol?
1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol has a molecular weight of 376.29 g/mol, XLogP of 4.49, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(4,7-dichloro-1H-indazol-6-yl)phenyl]methyl]piperidin-4-ol is sourced from PubChem (CID 162718521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).