C22H21ClN2O5 — CID 142932011
5-(5-chloro-2,4-dihydroxyphenyl)-4-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]-1,2-oxazole-3-carbaldehyde (PubChem CID 142932011) has the molecular formula C22H21ClN2O5 and a molecular weight of 428.87 g/mol. Its IUPAC name is 5-(5-chloro-2,4-dihydroxyphenyl)-4-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]-1,2-oxazole-3-carbaldehyde.
| Compound Name | 5-(5-chloro-2,4-dihydroxyphenyl)-4-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 142932011 |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 5-(5-chloro-2,4-dihydroxyphenyl)-4-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]-1,2-oxazole-3-carbaldehyde |
| SMILES | O=Cc1noc(-c2cc(Cl)c(O)cc2O)c1-c1ccc(CN2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C22H21ClN2O5/c23-17-9-16(19(28)10-20(17)29)22-21(18(12-26)24-30-22)14-3-1-13(2-4-14)11-25-7-5-15(27)6-8-25/h1-4,9-10,12,15,27-29H,5-8,11H2 |
| InChIKey | YOTPFORAHLGESZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|