C32H42N4O6 — CID 143777979
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(7-formamidoheptyl)-4-[4-(morpholin-4-ylmethyl)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 143777979) has the molecular formula C32H42N4O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(7-formamidoheptyl)-4-[4-(morpholin-4-ylmethyl)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(7-formamidoheptyl)-4-[4-(morpholin-4-ylmethyl)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 143777979 |
| Molecular Formula | C32H42N4O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(7-formamidoheptyl)-4-[4-(morpholin-4-ylmethyl)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)c1cc(-c2onc(C(=O)NCCCCCCCNC=O)c2-c2ccc(CN3CCOCC3)cc2)c(O)cc1O |
| InChI | InChI=1S/C32H42N4O6/c1-22(2)25-18-26(28(39)19-27(25)38)31-29(24-10-8-23(9-11-24)20-36-14-16-41-17-15-36)30(35-42-31)32(40)34-13-7-5-3-4-6-12-33-21-37/h8-11,18-19,21-22,38-39H,3-7,12-17,20H2,1-2H3,(H,33,37)(H,34,40) |
| InChIKey | GQCDXMDSWJDEFL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|