C17H23FN2O8S2 — CID 122457876
2-[(2R)-2-(4-fluoro-N-formylanilino)-3-morpholin-4-yl-3-oxopropyl]sulfonylethyl methanesulfonate (PubChem CID 122457876) has the molecular formula C17H23FN2O8S2 and a molecular weight of 466.51 g/mol. Its IUPAC name is 2-[(2R)-2-(4-fluoro-N-formylanilino)-3-morpholin-4-yl-3-oxopropyl]sulfonylethyl methanesulfonate.
| Compound Name | 2-[(2R)-2-(4-fluoro-N-formylanilino)-3-morpholin-4-yl-3-oxopropyl]sulfonylethyl methanesulfonate |
|---|---|
| PubChem CID | 122457876 |
| Molecular Formula | C17H23FN2O8S2 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 2-[(2R)-2-(4-fluoro-N-formylanilino)-3-morpholin-4-yl-3-oxopropyl]sulfonylethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCS(=O)(=O)C[C@@H](C(=O)N1CCOCC1)N(C=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN2O8S2/c1-29(23,24)28-10-11-30(25,26)12-16(17(22)19-6-8-27-9-7-19)20(13-21)15-4-2-14(18)3-5-15/h2-5,13,16H,6-12H2,1H3/t16-/m0/s1 |
| InChIKey | LZOQBAJGVXXQTP-INIZCTEOSA-N |
| XLogP | -0.59 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|