C22H35FN2O6SSi — CID 140734604
N-[(2R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonyl]-1-morpholin-4-yl-1-oxopropan-2-yl]-4-fluorobenzamide (PubChem CID 140734604) has the molecular formula C22H35FN2O6SSi and a molecular weight of 502.68 g/mol. Its IUPAC name is N-[(2R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonyl]-1-morpholin-4-yl-1-oxopropan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[(2R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonyl]-1-morpholin-4-yl-1-oxopropan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 140734604 |
| Molecular Formula | C22H35FN2O6SSi |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | N-[(2R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonyl]-1-morpholin-4-yl-1-oxopropan-2-yl]-4-fluorobenzamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCS(=O)(=O)C[C@H](NC(=O)c1ccc(F)cc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H35FN2O6SSi/c1-22(2,3)33(4,5)31-14-15-32(28,29)16-19(21(27)25-10-12-30-13-11-25)24-20(26)17-6-8-18(23)9-7-17/h6-9,19H,10-16H2,1-5H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | OGWJXWYYIVIIPG-IBGZPJMESA-N |
| XLogP | 2.22 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|