About methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate
methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate (PubChem CID 122458447) has the molecular formula C21H26F2N2O3
and a molecular weight of 392.45 g/mol. Its IUPAC name is methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate |
| PubChem CID | 122458447 |
| Molecular Formula | C21H26F2N2O3 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate |
| SMILES | COC(=O)c1c(C)n(C(C)C2CCN(C(=O)C(F)F)C(C)C2)c2ccccc12 |
| InChI | InChI=1S/C21H26F2N2O3/c1-12-11-15(9-10-24(12)20(26)19(22)23)13(2)25-14(3)18(21(27)28-4)16-7-5-6-8-17(16)25/h5-8,12-13,15,19H,9-11H2,1-4H3 |
| InChIKey | GUAWKFFZMVUOHF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate?
The IUPAC name of methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate (CID 122458447) is methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate.
What is the SMILES notation for methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate?
The canonical SMILES for methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate is COC(=O)c1c(C)n(C(C)C2CCN(C(=O)C(F)F)C(C)C2)c2ccccc12.
What is the InChIKey of methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate?
The InChIKey is GUAWKFFZMVUOHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26F2N2O3/c1-12-11-15(9-10-24(12)20(26)19(22)23)13(2)25-14(3)18(21(27)28-4)16-7-5-6-8-17(16)25/h5-8,12-13,15,19H,9-11H2,1-4H3.
What are the key properties of methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate?
methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate has a molecular weight of 392.45 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[1-[1-(2,2-difluoroacetyl)-2-methylpiperidin-4-yl]ethyl]-2-methylindole-3-carboxylate is sourced from PubChem (CID 122458447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).