About methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate
methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate (PubChem CID 156540397) has the molecular formula C23H30F2N2O2
and a molecular weight of 404.50 g/mol. Its IUPAC name is methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate |
| PubChem CID | 156540397 |
| Molecular Formula | C23H30F2N2O2 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate |
| SMILES | COC(=O)c1c(C)n(C(C)C2CCC(NC3CC(F)(F)C3)CC2)c2ccccc12 |
| InChI | InChI=1S/C23H30F2N2O2/c1-14(16-8-10-17(11-9-16)26-18-12-23(24,25)13-18)27-15(2)21(22(28)29-3)19-6-4-5-7-20(19)27/h4-7,14,16-18,26H,8-13H2,1-3H3 |
| InChIKey | LWRTZPHCGGATCX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate?
The IUPAC name of methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate (CID 156540397) is methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate.
What is the SMILES notation for methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate?
The canonical SMILES for methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate is COC(=O)c1c(C)n(C(C)C2CCC(NC3CC(F)(F)C3)CC2)c2ccccc12.
What is the InChIKey of methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate?
The InChIKey is LWRTZPHCGGATCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30F2N2O2/c1-14(16-8-10-17(11-9-16)26-18-12-23(24,25)13-18)27-15(2)21(22(28)29-3)19-6-4-5-7-20(19)27/h4-7,14,16-18,26H,8-13H2,1-3H3.
What are the key properties of methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate?
methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate has a molecular weight of 404.50 g/mol, XLogP of 5.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[1-[4-[(3,3-difluorocyclobutyl)amino]cyclohexyl]ethyl]-2-methylindole-3-carboxylate is sourced from PubChem (CID 156540397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).