C22H17ClFN3O4S — CID 122458685
5-chloro-2-fluoro-4-[3-(2-methoxyphenyl)indazol-1-yl]-N-methylsulfonylbenzamide (PubChem CID 122458685) has the molecular formula C22H17ClFN3O4S and a molecular weight of 473.91 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[3-(2-methoxyphenyl)indazol-1-yl]-N-methylsulfonylbenzamide.
| Compound Name | 5-chloro-2-fluoro-4-[3-(2-methoxyphenyl)indazol-1-yl]-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 122458685 |
| Molecular Formula | C22H17ClFN3O4S |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 5-chloro-2-fluoro-4-[3-(2-methoxyphenyl)indazol-1-yl]-N-methylsulfonylbenzamide |
| SMILES | COc1ccccc1-c1nn(-c2cc(F)c(C(=O)NS(C)(=O)=O)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C22H17ClFN3O4S/c1-31-20-10-6-4-8-14(20)21-13-7-3-5-9-18(13)27(25-21)19-12-17(24)15(11-16(19)23)22(28)26-32(2,29)30/h3-12H,1-2H3,(H,26,28) |
| InChIKey | YXZOSMGRGHRIGL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |