C20H12Cl2F2N4O3S — CID 122458705
5-chloro-4-[3-chloro-5-(2-fluoro-3-pyridinyl)indazol-1-yl]-2-fluoro-N-methylsulfonylbenzamide (PubChem CID 122458705) has the molecular formula C20H12Cl2F2N4O3S and a molecular weight of 497.31 g/mol. Its IUPAC name is 5-chloro-4-[3-chloro-5-(2-fluoro-3-pyridinyl)indazol-1-yl]-2-fluoro-N-methylsulfonylbenzamide.
| Compound Name | 5-chloro-4-[3-chloro-5-(2-fluoro-3-pyridinyl)indazol-1-yl]-2-fluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 122458705 |
| Molecular Formula | C20H12Cl2F2N4O3S |
| Molecular Weight | 497.31 g/mol |
| Exact Mass | 496.00 |
| IUPAC Name | 5-chloro-4-[3-chloro-5-(2-fluoro-3-pyridinyl)indazol-1-yl]-2-fluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(Cl)c(-n2nc(Cl)c3cc(-c4cccnc4F)ccc32)cc1F |
| InChI | InChI=1S/C20H12Cl2F2N4O3S/c1-32(30,31)27-20(29)12-8-14(21)17(9-15(12)23)28-16-5-4-10(7-13(16)18(22)26-28)11-3-2-6-25-19(11)24/h2-9H,1H3,(H,27,29) |
| InChIKey | BSVJOZWLEOUTPH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|