C29H31FN4O7 — CID 122459949
cis-(1R,3S)-3-[(4-fluorophenyl)methyl-[2-[(5R)-6'-(methylcarbamoylamino)-2',4-dioxospiro[1,3-oxazolidine-5,3'-1H-indene]-3-yl]acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122459949) has the molecular formula C29H31FN4O7 and a molecular weight of 566.59 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(4-fluorophenyl)methyl-[2-[(5R)-6'-(methylcarbamoylamino)-2',4-dioxospiro[1,3-oxazolidine-5,3'-1H-indene]-3-yl]acetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[(4-fluorophenyl)methyl-[2-[(5R)-6'-(methylcarbamoylamino)-2',4-dioxospiro[1,3-oxazolidine-5,3'-1H-indene]-3-yl]acetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122459949 |
| Molecular Formula | C29H31FN4O7 |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | cis-(1R,3S)-3-[(4-fluorophenyl)methyl-[2-[(5R)-6'-(methylcarbamoylamino)-2',4-dioxospiro[1,3-oxazolidine-5,3'-1H-indene]-3-yl]acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CNC(=O)Nc1ccc2c(c1)CC(=O)[C@]21OCN(CC(=O)N(Cc2ccc(F)cc2)[C@H]2CCC[C@@H](C(=O)O)C2)C1=O |
| InChI | InChI=1S/C29H31FN4O7/c1-31-28(40)32-21-9-10-23-19(11-21)13-24(35)29(23)27(39)33(16-41-29)15-25(36)34(14-17-5-7-20(30)8-6-17)22-4-2-3-18(12-22)26(37)38/h5-11,18,22H,2-4,12-16H2,1H3,(H,37,38)(H2,31,32,40)/t18-,22+,29-/m1/s1 |
| InChIKey | PQYPSCUYESZOGF-WACOAXRMSA-N |
| XLogP | 2.39 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|