C27H28F4N4O5 — CID 122459899
2-amino-N-[(5R)-3-[2-[(4-fluorophenyl)methyl-[(2S)-1,1,1-trifluoropropan-2-yl]amino]-2-oxoethyl]-2',4-dioxospiro[1,3-oxazolidine-5,1'-3H-indene]-5'-yl]-2-methylpropanamide (PubChem CID 122459899) has the molecular formula C27H28F4N4O5 and a molecular weight of 564.54 g/mol. Its IUPAC name is 2-amino-N-[(5R)-3-[2-[(4-fluorophenyl)methyl-[(2S)-1,1,1-trifluoropropan-2-yl]amino]-2-oxoethyl]-2',4-dioxospiro[1,3-oxazolidine-5,1'-3H-indene]-5'-yl]-2-methylpropanamide.
| Compound Name | 2-amino-N-[(5R)-3-[2-[(4-fluorophenyl)methyl-[(2S)-1,1,1-trifluoropropan-2-yl]amino]-2-oxoethyl]-2',4-dioxospiro[1,3-oxazolidine-5,1'-3H-indene]-5'-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 122459899 |
| Molecular Formula | C27H28F4N4O5 |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 2-amino-N-[(5R)-3-[2-[(4-fluorophenyl)methyl-[(2S)-1,1,1-trifluoropropan-2-yl]amino]-2-oxoethyl]-2',4-dioxospiro[1,3-oxazolidine-5,1'-3H-indene]-5'-yl]-2-methylpropanamide |
| SMILES | C[C@H](N(Cc1ccc(F)cc1)C(=O)CN1CO[C@]2(C(=O)Cc3cc(NC(=O)C(C)(C)N)ccc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C27H28F4N4O5/c1-15(27(29,30)31)35(12-16-4-6-18(28)7-5-16)22(37)13-34-14-40-26(24(34)39)20-9-8-19(10-17(20)11-21(26)36)33-23(38)25(2,3)32/h4-10,15H,11-14,32H2,1-3H3,(H,33,38)/t15-,26+/m0/s1 |
| InChIKey | RADZDVGSUUQFNR-QWXGXRTQSA-N |
| XLogP | 2.62 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|