C30H27F4N5O4 — CID 135204557
2-[(5R)-6'-[1-(cyanomethyl)-3,5-dimethylpyrazol-4-yl]-2',4-dioxospiro[1,3-oxazolidine-5,3'-1H-indene]-3-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 135204557) has the molecular formula C30H27F4N5O4 and a molecular weight of 597.57 g/mol. Its IUPAC name is 2-[(5R)-6'-[1-(cyanomethyl)-3,5-dimethylpyrazol-4-yl]-2',4-dioxospiro[1,3-oxazolidine-5,3'-1H-indene]-3-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | 2-[(5R)-6'-[1-(cyanomethyl)-3,5-dimethylpyrazol-4-yl]-2',4-dioxospiro[1,3-oxazolidine-5,3'-1H-indene]-3-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 135204557 |
| Molecular Formula | C30H27F4N5O4 |
| Molecular Weight | 597.57 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 2-[(5R)-6'-[1-(cyanomethyl)-3,5-dimethylpyrazol-4-yl]-2',4-dioxospiro[1,3-oxazolidine-5,3'-1H-indene]-3-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | Cc1nn(CC#N)c(C)c1-c1ccc2c(c1)CC(=O)[C@]21OCN(CC(=O)N(Cc2ccc(F)cc2)[C@@H](C)C(F)(F)F)C1=O |
| InChI | InChI=1S/C30H27F4N5O4/c1-17-27(18(2)39(36-17)11-10-35)21-6-9-24-22(12-21)13-25(40)29(24)28(42)37(16-43-29)15-26(41)38(19(3)30(32,33)34)14-20-4-7-23(31)8-5-20/h4-9,12,19H,11,13-16H2,1-3H3/t19-,29+/m0/s1 |
| InChIKey | LWWDWICISRMGFH-ADXZGYQBSA-N |
| XLogP | 3.95 |
| TPSA | 108.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|