C20H15F3N2O2S — CID 122461098
benzyl 2-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate (PubChem CID 122461098) has the molecular formula C20H15F3N2O2S and a molecular weight of 404.41 g/mol. Its IUPAC name is benzyl 2-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate.
| Compound Name | benzyl 2-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 122461098 |
| Molecular Formula | C20H15F3N2O2S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | benzyl 2-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCc2nc(-c3cc(F)c(F)c(F)c3)sc2C1 |
| InChI | InChI=1S/C20H15F3N2O2S/c21-14-8-13(9-15(22)18(14)23)19-24-16-6-7-25(10-17(16)28-19)20(26)27-11-12-4-2-1-3-5-12/h1-5,8-9H,6-7,10-11H2 |
| InChIKey | HRCGWLMDXCJHKS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|