C24H25F6N5O6 — CID 122468983
[1-[[2,5-dimethyl-7-[(2,3,6-trifluorophenyl)methoxy]pyrazolo[4,3-b]pyridine-3-carbonyl]amino]-2-methylbutan-2-yl]carbamic acid;2,2,2-trifluoroacetic acid (PubChem CID 122468983) has the molecular formula C24H25F6N5O6 and a molecular weight of 593.48 g/mol. Its IUPAC name is [1-[[2,5-dimethyl-7-[(2,3,6-trifluorophenyl)methoxy]pyrazolo[4,3-b]pyridine-3-carbonyl]amino]-2-methylbutan-2-yl]carbamic acid;2,2,2-trifluoroacetic acid.
| Compound Name | [1-[[2,5-dimethyl-7-[(2,3,6-trifluorophenyl)methoxy]pyrazolo[4,3-b]pyridine-3-carbonyl]amino]-2-methylbutan-2-yl]carbamic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 122468983 |
| Molecular Formula | C24H25F6N5O6 |
| Molecular Weight | 593.48 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | [1-[[2,5-dimethyl-7-[(2,3,6-trifluorophenyl)methoxy]pyrazolo[4,3-b]pyridine-3-carbonyl]amino]-2-methylbutan-2-yl]carbamic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCC(C)(CNC(=O)c1c2nc(C)cc(OCc3c(F)ccc(F)c3F)c2nn1C)NC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24F3N5O4.C2HF3O2/c1-5-22(3,28-21(32)33)10-26-20(31)19-18-17(29-30(19)4)15(8-11(2)27-18)34-9-12-13(23)6-7-14(24)16(12)25;3-2(4,5)1(6)7/h6-8,28H,5,9-10H2,1-4H3,(H,26,31)(H,32,33);(H,6,7) |
| InChIKey | WRAOFMLNNAJDHA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|