C30H36N6O3 — CID 122470420
tert-butyl 4-[[4-[2-(quinolin-4-ylamino)ethylamino]quinazolin-7-yl]oxymethyl]piperidine-1-carboxylate (PubChem CID 122470420) has the molecular formula C30H36N6O3 and a molecular weight of 528.66 g/mol. Its IUPAC name is tert-butyl 4-[[4-[2-(quinolin-4-ylamino)ethylamino]quinazolin-7-yl]oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[2-(quinolin-4-ylamino)ethylamino]quinazolin-7-yl]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 122470420 |
| Molecular Formula | C30H36N6O3 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | tert-butyl 4-[[4-[2-(quinolin-4-ylamino)ethylamino]quinazolin-7-yl]oxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COc2ccc3c(NCCNc4ccnc5ccccc45)ncnc3c2)CC1 |
| InChI | InChI=1S/C30H36N6O3/c1-30(2,3)39-29(37)36-16-11-21(12-17-36)19-38-22-8-9-24-27(18-22)34-20-35-28(24)33-15-14-32-26-10-13-31-25-7-5-4-6-23(25)26/h4-10,13,18,20-21H,11-12,14-17,19H2,1-3H3,(H,31,32)(H,33,34,35) |
| InChIKey | MYAQTYJHXSAEGW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|