C14H17BrO4 — CID 122472796
2-[(2-bromo-4-tert-butylphenyl)methyl]propanedioic acid (PubChem CID 122472796) has the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. Its IUPAC name is 2-[(2-bromo-4-tert-butylphenyl)methyl]propanedioic acid.
| Compound Name | 2-[(2-bromo-4-tert-butylphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 122472796 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-[(2-bromo-4-tert-butylphenyl)methyl]propanedioic acid |
| SMILES | CC(C)(C)c1ccc(CC(C(=O)O)C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C14H17BrO4/c1-14(2,3)9-5-4-8(11(15)7-9)6-10(12(16)17)13(18)19/h4-5,7,10H,6H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | AQAVTKRGSJGDDD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|