C25H24FN7O2 — CID 122475585
N-[5-[[8-(3-fluorophenyl)imidazo[1,5-a][1,3,5]triazin-2-yl]amino]-2-(1-methylpyrrolidin-3-yl)oxyphenyl]prop-2-enamide (PubChem CID 122475585) has the molecular formula C25H24FN7O2 and a molecular weight of 473.51 g/mol. Its IUPAC name is N-[5-[[8-(3-fluorophenyl)imidazo[1,5-a][1,3,5]triazin-2-yl]amino]-2-(1-methylpyrrolidin-3-yl)oxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[8-(3-fluorophenyl)imidazo[1,5-a][1,3,5]triazin-2-yl]amino]-2-(1-methylpyrrolidin-3-yl)oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122475585 |
| Molecular Formula | C25H24FN7O2 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[5-[[8-(3-fluorophenyl)imidazo[1,5-a][1,3,5]triazin-2-yl]amino]-2-(1-methylpyrrolidin-3-yl)oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncn3cnc(-c4cccc(F)c4)c3n2)ccc1OC1CCN(C)C1 |
| InChI | InChI=1S/C25H24FN7O2/c1-3-22(34)30-20-12-18(7-8-21(20)35-19-9-10-32(2)13-19)29-25-28-15-33-14-27-23(24(33)31-25)16-5-4-6-17(26)11-16/h3-8,11-12,14-15,19H,1,9-10,13H2,2H3,(H,29,31)(H,30,34) |
| InChIKey | PXJCDGHTIARGBE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|