C12H10ClNO3 — CID 122476580
2-(4-chlorophenyl)-5-(methoxymethyl)-1,3-oxazole-4-carbaldehyde (PubChem CID 122476580) has the molecular formula C12H10ClNO3 and a molecular weight of 251.67 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(methoxymethyl)-1,3-oxazole-4-carbaldehyde.
| Compound Name | 2-(4-chlorophenyl)-5-(methoxymethyl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 122476580 |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(methoxymethyl)-1,3-oxazole-4-carbaldehyde |
| SMILES | COCc1oc(-c2ccc(Cl)cc2)nc1C=O |
| InChI | InChI=1S/C12H10ClNO3/c1-16-7-11-10(6-15)14-12(17-11)8-2-4-9(13)5-3-8/h2-6H,7H2,1H3 |
| InChIKey | UNPZZLKPGHWORD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|