C17H11N5OS — CID 122479001
5-(7-methoxy-4-thiophen-3-ylquinolin-2-yl)-2H-triazole-4-carbonitrile (PubChem CID 122479001) has the molecular formula C17H11N5OS and a molecular weight of 333.38 g/mol. Its IUPAC name is 5-(7-methoxy-4-thiophen-3-ylquinolin-2-yl)-2H-triazole-4-carbonitrile.
| Compound Name | 5-(7-methoxy-4-thiophen-3-ylquinolin-2-yl)-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122479001 |
| Molecular Formula | C17H11N5OS |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 5-(7-methoxy-4-thiophen-3-ylquinolin-2-yl)-2H-triazole-4-carbonitrile |
| SMILES | COc1ccc2c(-c3ccsc3)cc(-c3n[nH]nc3C#N)nc2c1 |
| InChI | InChI=1S/C17H11N5OS/c1-23-11-2-3-12-13(10-4-5-24-9-10)7-15(19-14(12)6-11)17-16(8-18)20-22-21-17/h2-7,9H,1H3,(H,20,21,22) |
| InChIKey | DMSKSMIMRUCHDD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |