C9H12FN2O7PS — CID 122480567
1-[(2R,3R,4R,5R)-4-dihydroxyphosphinothioyloxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 122480567) has the molecular formula C9H12FN2O7PS and a molecular weight of 342.24 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-4-dihydroxyphosphinothioyloxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-4-dihydroxyphosphinothioyloxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 122480567 |
| Molecular Formula | C9H12FN2O7PS |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-4-dihydroxyphosphinothioyloxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](OP(O)(O)=S)[C@H]2F)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12FN2O7PS/c10-6-7(19-20(16,17)21)4(3-13)18-8(6)12-2-1-5(14)11-9(12)15/h1-2,4,6-8,13H,3H2,(H,11,14,15)(H2,16,17,21)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | DYMMRRMAGTZYSQ-XVFCMESISA-N |
| XLogP | -1.64 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|