C14H19ClN2O3 — CID 122483135
3-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-(4-chlorophenyl)propanoic acid (PubChem CID 122483135) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-(4-chlorophenyl)propanoic acid.
| Compound Name | 3-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-(4-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 122483135 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-(4-chlorophenyl)propanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)NC(CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O3/c1-8(2)13(16)14(20)17-11(7-12(18)19)9-3-5-10(15)6-4-9/h3-6,8,11,13H,7,16H2,1-2H3,(H,17,20)(H,18,19)/t11?,13-/m0/s1 |
| InChIKey | FHQHIEVOCBOQLC-YUZLPWPTSA-N |
| XLogP | 1.96 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |