C6H8NaO10P — CID 122483760
CID 122483760 (PubChem CID 122483760) has the molecular formula C6H8NaO10P and a molecular weight of 294.08 g/mol.
| Compound Name | CID 122483760 |
|---|---|
| PubChem CID | 122483760 |
| Molecular Formula | C6H8NaO10P |
| Molecular Weight | 294.08 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | — |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.O=P(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H8O7.Na.HO3P/c7-3(8)1-6(13,5(11)12)2-4(9)10;;1-4(2)3/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;(H,1,2,3)/q;+1;/p-1 |
| InChIKey | GGQAHXJIWQUBJY-UHFFFAOYSA-M |
| XLogP | -4.81 |
| TPSA | 189.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.08 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|