C18H22N2O4 — CID 122485733
4-methyl-10-(2-methylbutan-2-yl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 122485733) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-methyl-10-(2-methylbutan-2-yl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | 4-methyl-10-(2-methylbutan-2-yl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 122485733 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-methyl-10-(2-methylbutan-2-yl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | CCC(C)(C)N1C(=O)C2C3C=CC(C4C(=O)N(C)C(=O)C34)C2C1=O |
| InChI | InChI=1S/C18H22N2O4/c1-5-18(2,3)20-16(23)12-8-6-7-9(13(12)17(20)24)11-10(8)14(21)19(4)15(11)22/h6-13H,5H2,1-4H3 |
| InChIKey | CUUJGCRNWAZQPS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|