C45H28N2O2S — CID 122486367
15-phenyl-5-[10-(4-phenylphenyl)anthracen-9-yl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide (PubChem CID 122486367) has the molecular formula C45H28N2O2S and a molecular weight of 660.80 g/mol. Its IUPAC name is 15-phenyl-5-[10-(4-phenylphenyl)anthracen-9-yl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide.
| Compound Name | 15-phenyl-5-[10-(4-phenylphenyl)anthracen-9-yl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide |
|---|---|
| PubChem CID | 122486367 |
| Molecular Formula | C45H28N2O2S |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | 15-phenyl-5-[10-(4-phenylphenyl)anthracen-9-yl]-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide |
| SMILES | O=S1(=O)c2cc(-c3c4ccccc4c(-c4ccc(-c5ccccc5)cc4)c4ccccc34)ccc2-n2c(-c3ccccc3)nc3cccc1c32 |
| InChI | InChI=1S/C45H28N2O2S/c48-50(49)40-21-11-20-38-44(40)47(45(46-38)32-14-5-2-6-15-32)39-27-26-33(28-41(39)50)43-36-18-9-7-16-34(36)42(35-17-8-10-19-37(35)43)31-24-22-30(23-25-31)29-12-3-1-4-13-29/h1-28H |
| InChIKey | WHDXGCMLGOIKOP-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|