C38H23N3O2S — CID 122486370
15-phenyl-5-(10-pyridin-3-ylanthracen-9-yl)-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide (PubChem CID 122486370) has the molecular formula C38H23N3O2S and a molecular weight of 585.69 g/mol. Its IUPAC name is 15-phenyl-5-(10-pyridin-3-ylanthracen-9-yl)-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide.
| Compound Name | 15-phenyl-5-(10-pyridin-3-ylanthracen-9-yl)-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide |
|---|---|
| PubChem CID | 122486370 |
| Molecular Formula | C38H23N3O2S |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | 15-phenyl-5-(10-pyridin-3-ylanthracen-9-yl)-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8,8-dioxide |
| SMILES | O=S1(=O)c2cc(-c3c4ccccc4c(-c4cccnc4)c4ccccc34)ccc2-n2c(-c3ccccc3)nc3cccc1c32 |
| InChI | InChI=1S/C38H23N3O2S/c42-44(43)33-18-8-17-31-37(33)41(38(40-31)24-10-2-1-3-11-24)32-20-19-25(22-34(32)44)35-27-13-4-6-15-29(27)36(26-12-9-21-39-23-26)30-16-7-5-14-28(30)35/h1-23H |
| InChIKey | JMSWQEBDCGVPOA-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|