C45H31N3O2S — CID 122486532
7-[10-(15-ethyl-8,8-dioxo-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-4-yl)anthracen-9-yl]-9,9-dimethylfluorene-2-carbonitrile (PubChem CID 122486532) has the molecular formula C45H31N3O2S and a molecular weight of 677.83 g/mol. Its IUPAC name is 7-[10-(15-ethyl-8,8-dioxo-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-4-yl)anthracen-9-yl]-9,9-dimethylfluorene-2-carbonitrile.
| Compound Name | 7-[10-(15-ethyl-8,8-dioxo-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-4-yl)anthracen-9-yl]-9,9-dimethylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 122486532 |
| Molecular Formula | C45H31N3O2S |
| Molecular Weight | 677.83 g/mol |
| Exact Mass | 677.21 |
| IUPAC Name | 7-[10-(15-ethyl-8,8-dioxo-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-4-yl)anthracen-9-yl]-9,9-dimethylfluorene-2-carbonitrile |
| SMILES | CCc1nc2cccc3c2n1-c1cc(-c2c4ccccc4c(-c4ccc5c(c4)C(C)(C)c4cc(C#N)ccc4-5)c4ccccc24)ccc1S3(=O)=O |
| InChI | InChI=1S/C45H31N3O2S/c1-4-41-47-37-14-9-15-40-44(37)48(41)38-24-28(18-21-39(38)51(40,49)50)43-33-12-7-5-10-31(33)42(32-11-6-8-13-34(32)43)27-17-20-30-29-19-16-26(25-46)22-35(29)45(2,3)36(30)23-27/h5-24H,4H2,1-3H3 |
| InChIKey | IOPQNWJQSSOHSK-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.83 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|