C23H32N2O6 — CID 122489316
tert-butyl 3-[[1-ethoxy-3-(4-methylphenyl)-1,3-dioxopropan-2-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 122489316) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl 3-[[1-ethoxy-3-(4-methylphenyl)-1,3-dioxopropan-2-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[1-ethoxy-3-(4-methylphenyl)-1,3-dioxopropan-2-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 122489316 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | tert-butyl 3-[[1-ethoxy-3-(4-methylphenyl)-1,3-dioxopropan-2-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C(NC(=O)C1CCCN(C(=O)OC(C)(C)C)C1)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H32N2O6/c1-6-30-21(28)18(19(26)16-11-9-15(2)10-12-16)24-20(27)17-8-7-13-25(14-17)22(29)31-23(3,4)5/h9-12,17-18H,6-8,13-14H2,1-5H3,(H,24,27) |
| InChIKey | UOYTWBZQFGXXKR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|