C12H16F3N3O — CID 122490238
N-[[1-cyclohexyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]formamide (PubChem CID 122490238) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is N-[[1-cyclohexyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]formamide.
| Compound Name | N-[[1-cyclohexyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]formamide |
|---|---|
| PubChem CID | 122490238 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[[1-cyclohexyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]formamide |
| SMILES | O=CNCc1cn(C2CCCCC2)nc1C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O/c13-12(14,15)11-9(6-16-8-19)7-18(17-11)10-4-2-1-3-5-10/h7-8,10H,1-6H2,(H,16,19) |
| InChIKey | NZDNGOKNLPHCON-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|