C44H32N2O2 — CID 122491735
1-(3-cyclohexa-1,5-dien-1-yl-5-phenylphenyl)-4-(3,5-diphenylphenyl)quinoxaline-2,3-dione (PubChem CID 122491735) has the molecular formula C44H32N2O2 and a molecular weight of 620.75 g/mol. Its IUPAC name is 1-(3-cyclohexa-1,5-dien-1-yl-5-phenylphenyl)-4-(3,5-diphenylphenyl)quinoxaline-2,3-dione.
| Compound Name | 1-(3-cyclohexa-1,5-dien-1-yl-5-phenylphenyl)-4-(3,5-diphenylphenyl)quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 122491735 |
| Molecular Formula | C44H32N2O2 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | 1-(3-cyclohexa-1,5-dien-1-yl-5-phenylphenyl)-4-(3,5-diphenylphenyl)quinoxaline-2,3-dione |
| SMILES | O=c1c(=O)n(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2ccccc2n1-c1cc(C2=CCCC=C2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C44H32N2O2/c47-43-44(48)46(40-29-37(33-19-9-3-10-20-33)26-38(30-40)34-21-11-4-12-22-34)42-24-14-13-23-41(42)45(43)39-27-35(31-15-5-1-6-16-31)25-36(28-39)32-17-7-2-8-18-32/h1-3,5-11,13-30H,4,12H2 |
| InChIKey | WCEXZVIKBVCGSM-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|