C28H21Cl2N3O4 — CID 122491873
13-[[5-cyclopropyl-3-(2,6-dichlorophenyl)triazol-4-yl]methoxy]-2-oxotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-5-carboxylic acid (PubChem CID 122491873) has the molecular formula C28H21Cl2N3O4 and a molecular weight of 534.40 g/mol. Its IUPAC name is 13-[[5-cyclopropyl-3-(2,6-dichlorophenyl)triazol-4-yl]methoxy]-2-oxotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-5-carboxylic acid.
| Compound Name | 13-[[5-cyclopropyl-3-(2,6-dichlorophenyl)triazol-4-yl]methoxy]-2-oxotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 122491873 |
| Molecular Formula | C28H21Cl2N3O4 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 13-[[5-cyclopropyl-3-(2,6-dichlorophenyl)triazol-4-yl]methoxy]-2-oxotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)c1ccc(OCc3c(C4CC4)nnn3-c3c(Cl)cccc3Cl)cc1CC2 |
| InChI | InChI=1S/C28H21Cl2N3O4/c29-22-2-1-3-23(30)26(22)33-24(25(31-32-33)16-6-7-16)14-37-19-10-11-20-17(12-19)8-4-15-5-9-18(28(35)36)13-21(15)27(20)34/h1-3,5,9-13,16H,4,6-8,14H2,(H,35,36) |
| InChIKey | MYUKLYOYWGNVEN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |