C28H28Cl2N4O3 — CID 24862820
3-[[4-[[3-(2,6-dichlorophenyl)-5-propan-2-yltriazol-4-yl]methoxy]-N,2-dimethylanilino]methyl]benzoic acid (PubChem CID 24862820) has the molecular formula C28H28Cl2N4O3 and a molecular weight of 539.46 g/mol. Its IUPAC name is 3-[[4-[[3-(2,6-dichlorophenyl)-5-propan-2-yltriazol-4-yl]methoxy]-N,2-dimethylanilino]methyl]benzoic acid.
| Compound Name | 3-[[4-[[3-(2,6-dichlorophenyl)-5-propan-2-yltriazol-4-yl]methoxy]-N,2-dimethylanilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 24862820 |
| Molecular Formula | C28H28Cl2N4O3 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 3-[[4-[[3-(2,6-dichlorophenyl)-5-propan-2-yltriazol-4-yl]methoxy]-N,2-dimethylanilino]methyl]benzoic acid |
| SMILES | Cc1cc(OCc2c(C(C)C)nnn2-c2c(Cl)cccc2Cl)ccc1N(C)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C28H28Cl2N4O3/c1-17(2)26-25(34(32-31-26)27-22(29)9-6-10-23(27)30)16-37-21-11-12-24(18(3)13-21)33(4)15-19-7-5-8-20(14-19)28(35)36/h5-14,17H,15-16H2,1-4H3,(H,35,36) |
| InChIKey | ZMQNWRIWGFMCQY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|