C31H33Cl2N3O3 — CID 67528315
2-[2-[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]ethyl]-4-methylbenzoic acid (PubChem CID 67528315) has the molecular formula C31H33Cl2N3O3 and a molecular weight of 566.53 g/mol. Its IUPAC name is 2-[2-[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]ethyl]-4-methylbenzoic acid.
| Compound Name | 2-[2-[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]ethyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 67528315 |
| Molecular Formula | C31H33Cl2N3O3 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-[2-[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]ethyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(CCN(C)c2ccc(OCc3c(C(C)C)cnn3-c3c(Cl)cccc3Cl)cc2C)c1 |
| InChI | InChI=1S/C31H33Cl2N3O3/c1-19(2)25-17-34-36(30-26(32)7-6-8-27(30)33)29(25)18-39-23-10-12-28(21(4)16-23)35(5)14-13-22-15-20(3)9-11-24(22)31(37)38/h6-12,15-17,19H,13-14,18H2,1-5H3,(H,37,38) |
| InChIKey | BXMZWGQMGVENBA-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|