C23H31N5O2S — CID 122492018
2-[2-[2-(3-butoxy-4-methoxyphenyl)-5-propyl-1,3-thiazol-4-yl]ethyl]pyrimidine-4,6-diamine (PubChem CID 122492018) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is 2-[2-[2-(3-butoxy-4-methoxyphenyl)-5-propyl-1,3-thiazol-4-yl]ethyl]pyrimidine-4,6-diamine.
| Compound Name | 2-[2-[2-(3-butoxy-4-methoxyphenyl)-5-propyl-1,3-thiazol-4-yl]ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 122492018 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-[2-[2-(3-butoxy-4-methoxyphenyl)-5-propyl-1,3-thiazol-4-yl]ethyl]pyrimidine-4,6-diamine |
| SMILES | CCCCOc1cc(-c2nc(CCc3nc(N)cc(N)n3)c(CCC)s2)ccc1OC |
| InChI | InChI=1S/C23H31N5O2S/c1-4-6-12-30-18-13-15(8-10-17(18)29-3)23-26-16(19(31-23)7-5-2)9-11-22-27-20(24)14-21(25)28-22/h8,10,13-14H,4-7,9,11-12H2,1-3H3,(H4,24,25,27,28) |
| InChIKey | DOEHRFKYBFMADS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|