C16H22N2O2S — CID 82160764
5-(4-methoxy-3-pentoxyphenyl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 82160764) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 5-(4-methoxy-3-pentoxyphenyl)-4-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-(4-methoxy-3-pentoxyphenyl)-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82160764 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 5-(4-methoxy-3-pentoxyphenyl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | CCCCCOc1cc(-c2sc(N)nc2C)ccc1OC |
| InChI | InChI=1S/C16H22N2O2S/c1-4-5-6-9-20-14-10-12(7-8-13(14)19-3)15-11(2)18-16(17)21-15/h7-8,10H,4-6,9H2,1-3H3,(H2,17,18) |
| InChIKey | BQBZRTJVNQMWMR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|