C18H23N3O3S — CID 175592124
5-[2-(hexanoylamino)-4-methyl-1,3-thiazol-5-yl]-2-methoxybenzamide (PubChem CID 175592124) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 5-[2-(hexanoylamino)-4-methyl-1,3-thiazol-5-yl]-2-methoxybenzamide.
| Compound Name | 5-[2-(hexanoylamino)-4-methyl-1,3-thiazol-5-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 175592124 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 5-[2-(hexanoylamino)-4-methyl-1,3-thiazol-5-yl]-2-methoxybenzamide |
| SMILES | CCCCCC(=O)Nc1nc(C)c(-c2ccc(OC)c(C(N)=O)c2)s1 |
| InChI | InChI=1S/C18H23N3O3S/c1-4-5-6-7-15(22)21-18-20-11(2)16(25-18)12-8-9-14(24-3)13(10-12)17(19)23/h8-10H,4-7H2,1-3H3,(H2,19,23)(H,20,21,22) |
| InChIKey | PPFXITJIQNVRKJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|