C52H80N4O4 — CID 102597963
2,3-bis(3,4-dioctoxyphenyl)quinoxaline-6,7-diamine (PubChem CID 102597963) has the molecular formula C52H80N4O4 and a molecular weight of 825.24 g/mol. Its IUPAC name is 2,3-bis(3,4-dioctoxyphenyl)quinoxaline-6,7-diamine.
| Compound Name | 2,3-bis(3,4-dioctoxyphenyl)quinoxaline-6,7-diamine |
|---|---|
| PubChem CID | 102597963 |
| Molecular Formula | C52H80N4O4 |
| Molecular Weight | 825.24 g/mol |
| Exact Mass | 824.62 |
| IUPAC Name | 2,3-bis(3,4-dioctoxyphenyl)quinoxaline-6,7-diamine |
| SMILES | CCCCCCCCOc1ccc(-c2nc3cc(N)c(N)cc3nc2-c2ccc(OCCCCCCCC)c(OCCCCCCCC)c2)cc1OCCCCCCCC |
| InChI | InChI=1S/C52H80N4O4/c1-5-9-13-17-21-25-33-57-47-31-29-41(37-49(47)59-35-27-23-19-15-11-7-3)51-52(56-46-40-44(54)43(53)39-45(46)55-51)42-30-32-48(58-34-26-22-18-14-10-6-2)50(38-42)60-36-28-24-20-16-12-8-4/h29-32,37-40H,5-28,33-36,53-54H2,1-4H3 |
| InChIKey | OATDJWLCVKFOPC-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.24 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|