C34H50N4O4 — CID 102109061
3,6-bis(3,4-dipentoxyphenyl)-1,2,4,5-tetrazine (PubChem CID 102109061) has the molecular formula C34H50N4O4 and a molecular weight of 578.80 g/mol. Its IUPAC name is 3,6-bis(3,4-dipentoxyphenyl)-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(3,4-dipentoxyphenyl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 102109061 |
| Molecular Formula | C34H50N4O4 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.38 |
| IUPAC Name | 3,6-bis(3,4-dipentoxyphenyl)-1,2,4,5-tetrazine |
| SMILES | CCCCCOc1ccc(-c2nnc(-c3ccc(OCCCCC)c(OCCCCC)c3)nn2)cc1OCCCCC |
| InChI | InChI=1S/C34H50N4O4/c1-5-9-13-21-39-29-19-17-27(25-31(29)41-23-15-11-7-3)33-35-37-34(38-36-33)28-18-20-30(40-22-14-10-6-2)32(26-28)42-24-16-12-8-4/h17-20,25-26H,5-16,21-24H2,1-4H3 |
| InChIKey | NNJNELVBHUPZRH-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|