C19H18F3N3O4 — CID 122496931
(2R,3S,4R,5R)-2-[(R)-hydroxy-[3-(trifluoromethyl)phenyl]methyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 122496931) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(R)-hydroxy-[3-(trifluoromethyl)phenyl]methyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(R)-hydroxy-[3-(trifluoromethyl)phenyl]methyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 122496931 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-hydroxy-[3-(trifluoromethyl)phenyl]methyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@H]([C@H](O)c2cccc(C(F)(F)F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H18F3N3O4/c1-9-12-5-6-25(17(12)24-8-23-9)18-15(28)14(27)16(29-18)13(26)10-3-2-4-11(7-10)19(20,21)22/h2-8,13-16,18,26-28H,1H3/t13-,14+,15-,16-,18-/m1/s1 |
| InChIKey | WNGZPIOXKRMXPJ-ORDFZIBCSA-N |
| XLogP | 2.11 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |